C32H25F2N7O2S — CID 135126180
N-[(4aR,7aS)-7a-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-6-pyrimidin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 135126180) has the molecular formula C32H25F2N7O2S and a molecular weight of 609.66 g/mol. Its IUPAC name is N-[(4aR,7aS)-7a-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-6-pyrimidin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aR,7aS)-7a-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-6-pyrimidin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 135126180 |
| Molecular Formula | C32H25F2N7O2S |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | N-[(4aR,7aS)-7a-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-6-pyrimidin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | C#CCOc1cnc(/C(F)=C/c2ccc(F)c([C@]34CN(c5ncccn5)C[C@H]3CSC(NC(=O)c3ccccc3)=N4)c2)cn1 |
| InChI | InChI=1S/C32H25F2N7O2S/c1-2-13-43-28-17-37-27(16-38-28)26(34)15-21-9-10-25(33)24(14-21)32-20-41(30-35-11-6-12-36-30)18-23(32)19-44-31(40-32)39-29(42)22-7-4-3-5-8-22/h1,3-12,14-17,23H,13,18-20H2,(H,39,40,42)/b26-15-/t23-,32-/m0/s1 |
| InChIKey | MZCJURVOLPUSCX-ANVJISGHSA-N |
| XLogP | 4.75 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|