C26H22F3N7OS — CID 135126534
(4aR,7aS)-7a-[5-[(Z)-2-(5-but-3-yn-2-yloxypyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine (PubChem CID 135126534) has the molecular formula C26H22F3N7OS and a molecular weight of 537.57 g/mol. Its IUPAC name is (4aR,7aS)-7a-[5-[(Z)-2-(5-but-3-yn-2-yloxypyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,7aS)-7a-[5-[(Z)-2-(5-but-3-yn-2-yloxypyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 135126534 |
| Molecular Formula | C26H22F3N7OS |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (4aR,7aS)-7a-[5-[(Z)-2-(5-but-3-yn-2-yloxypyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine |
| SMILES | C#CC(C)Oc1cnc(/C(F)=C/c2ccc(F)c([C@]34CN(c5ncc(F)cn5)C[C@H]3CSC(N)=N4)c2)cn1 |
| InChI | InChI=1S/C26H22F3N7OS/c1-3-15(2)37-23-11-31-22(10-32-23)21(29)7-16-4-5-20(28)19(6-16)26-14-36(25-33-8-18(27)9-34-25)12-17(26)13-38-24(30)35-26/h1,4-11,15,17H,12-14H2,2H3,(H2,30,35)/b21-7-/t15?,17-,26-/m0/s1 |
| InChIKey | JXIRZJRQKBJGGS-NKXHRUEOSA-N |
| XLogP | 3.81 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|