C21H20F3N5O3S — CID 135126112
5-[5-[(Z)-2-(5-but-3-yn-2-yloxypyrazin-2-yl)-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 135126112) has the molecular formula C21H20F3N5O3S and a molecular weight of 479.48 g/mol. Its IUPAC name is 5-[5-[(Z)-2-(5-but-3-yn-2-yloxypyrazin-2-yl)-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | 5-[5-[(Z)-2-(5-but-3-yn-2-yloxypyrazin-2-yl)-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 135126112 |
| Molecular Formula | C21H20F3N5O3S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 5-[5-[(Z)-2-(5-but-3-yn-2-yloxypyrazin-2-yl)-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | C#CC(C)Oc1cnc(/C(F)=C/c2cc(F)c(F)c(C3(C)CS(=O)(=O)N(C)C(N)=N3)c2)cn1 |
| InChI | InChI=1S/C21H20F3N5O3S/c1-5-12(2)32-18-10-26-17(9-27-18)15(22)7-13-6-14(19(24)16(23)8-13)21(3)11-33(30,31)29(4)20(25)28-21/h1,6-10,12H,11H2,2-4H3,(H2,25,28)/b15-7- |
| InChIKey | KRUFNKSTSLXHAF-CHHVJCJISA-N |
| XLogP | 2.43 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|