C21H22F3N5O5S — CID 142379324
ethyl 2-[5-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyrazin-2-yl]oxyacetate (PubChem CID 142379324) has the molecular formula C21H22F3N5O5S and a molecular weight of 513.50 g/mol. Its IUPAC name is ethyl 2-[5-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyrazin-2-yl]oxyacetate.
| Compound Name | ethyl 2-[5-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyrazin-2-yl]oxyacetate |
|---|---|
| PubChem CID | 142379324 |
| Molecular Formula | C21H22F3N5O5S |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | ethyl 2-[5-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]pyrazin-2-yl]oxyacetate |
| SMILES | CCOC(=O)COc1cnc(/C(F)=C/c2cc(F)c(F)c([C@]3(C)CS(=O)(=O)N(C)C(N)=N3)c2)cn1 |
| InChI | InChI=1S/C21H22F3N5O5S/c1-4-33-18(30)10-34-17-9-26-16(8-27-17)14(22)6-12-5-13(19(24)15(23)7-12)21(2)11-35(31,32)29(3)20(25)28-21/h5-9H,4,10-11H2,1-3H3,(H2,25,28)/b14-6-/t21-/m0/s1 |
| InChIKey | BGOOUINKRUJXDU-XLPSYMGOSA-N |
| XLogP | 1.97 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |