C19H15ClF3N5O2S — CID 135125921
6-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]-5-chloropyridine-3-carbonitrile (PubChem CID 135125921) has the molecular formula C19H15ClF3N5O2S and a molecular weight of 469.88 g/mol. Its IUPAC name is 6-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]-5-chloropyridine-3-carbonitrile.
| Compound Name | 6-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]-5-chloropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135125921 |
| Molecular Formula | C19H15ClF3N5O2S |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 6-[(Z)-2-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4,5-difluorophenyl]-1-fluoroethenyl]-5-chloropyridine-3-carbonitrile |
| SMILES | CN1C(N)=N[C@](C)(c2cc(/C=C(\F)c3ncc(C#N)cc3Cl)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C19H15ClF3N5O2S/c1-19(9-31(29,30)28(2)18(25)27-19)12-3-10(5-14(21)16(12)23)6-15(22)17-13(20)4-11(7-24)8-26-17/h3-6,8H,9H2,1-2H3,(H2,25,27)/b15-6-/t19-/m0/s1 |
| InChIKey | XSTFBOBOPVTQOH-RQYCBZRCSA-N |
| XLogP | 3.16 |
| TPSA | 112.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |