C21H19F3N6O4S — CID 135125911
(5R)-5-[2,3-difluoro-5-[(Z)-2-fluoro-2-[5-(1,3-oxazol-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 135125911) has the molecular formula C21H19F3N6O4S and a molecular weight of 508.48 g/mol. Its IUPAC name is (5R)-5-[2,3-difluoro-5-[(Z)-2-fluoro-2-[5-(1,3-oxazol-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-[2,3-difluoro-5-[(Z)-2-fluoro-2-[5-(1,3-oxazol-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 135125911 |
| Molecular Formula | C21H19F3N6O4S |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | (5R)-5-[2,3-difluoro-5-[(Z)-2-fluoro-2-[5-(1,3-oxazol-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2cc(/C=C(\F)c3cnc(OCc4ncco4)cn3)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C21H19F3N6O4S/c1-21(11-35(31,32)30(2)20(25)29-21)13-5-12(7-15(23)19(13)24)6-14(22)16-8-28-17(9-27-16)34-10-18-26-3-4-33-18/h3-9H,10-11H2,1-2H3,(H2,25,29)/b14-6-/t21-/m0/s1 |
| InChIKey | LIGPEDYCRLXVKG-XLPSYMGOSA-N |
| XLogP | 2.59 |
| TPSA | 136.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |