C23H23F2N5O4S — CID 135125803
(3R)-3-[2-fluoro-5-[(Z)-2-fluoro-2-[5-(1,3-oxazol-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 135125803) has the molecular formula C23H23F2N5O4S and a molecular weight of 503.53 g/mol. Its IUPAC name is (3R)-3-[2-fluoro-5-[(Z)-2-fluoro-2-[5-(1,3-oxazol-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-[2-fluoro-5-[(Z)-2-fluoro-2-[5-(1,3-oxazol-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 135125803 |
| Molecular Formula | C23H23F2N5O4S |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | (3R)-3-[2-fluoro-5-[(Z)-2-fluoro-2-[5-(1,3-oxazol-2-ylmethoxy)pyrazin-2-yl]ethenyl]phenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(/C=C(\F)c3cnc(OCc4ncco4)cn3)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C23H23F2N5O4S/c1-22(2)21(26)30-23(3,13-35(22,31)32)15-8-14(4-5-16(15)24)9-17(25)18-10-29-19(11-28-18)34-12-20-27-6-7-33-20/h4-11H,12-13H2,1-3H3,(H2,26,30)/b17-9-/t23-/m0/s1 |
| InChIKey | QDOBYRKWCWCKSV-KEPADWISSA-N |
| XLogP | 3.43 |
| TPSA | 133.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |