C23H25F2N5O3S — CID 135125444
(5R)-5-[5-[(Z)-2-(5-but-2-ynoxypyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-3-amine (PubChem CID 135125444) has the molecular formula C23H25F2N5O3S and a molecular weight of 489.55 g/mol. Its IUPAC name is (5R)-5-[5-[(Z)-2-(5-but-2-ynoxypyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-[5-[(Z)-2-(5-but-2-ynoxypyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 135125444 |
| Molecular Formula | C23H25F2N5O3S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (5R)-5-[5-[(Z)-2-(5-but-2-ynoxypyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-3-amine |
| SMILES | CC#CCOc1cnc(/C(F)=C/c2ccc(F)c([C@@]3(C)N=C(N)N(C)S(=O)(=O)C3(C)C)c2)cn1 |
| InChI | InChI=1S/C23H25F2N5O3S/c1-6-7-10-33-20-14-27-19(13-28-20)18(25)12-15-8-9-17(24)16(11-15)23(4)22(2,3)34(31,32)30(5)21(26)29-23/h8-9,11-14H,10H2,1-5H3,(H2,26,29)/b18-12-/t23-/m1/s1 |
| InChIKey | GITRIHOLBUKCBI-KELOHDTKSA-N |
| XLogP | 3.07 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|