C23H24ClF3N4O4S — CID 135144005
tert-butyl N-[(5R)-5-[5-[(Z)-2-(5-chloro-2-pyridinyl)-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate (PubChem CID 135144005) has the molecular formula C23H24ClF3N4O4S and a molecular weight of 544.98 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-[5-[(Z)-2-(5-chloro-2-pyridinyl)-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5R)-5-[5-[(Z)-2-(5-chloro-2-pyridinyl)-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 135144005 |
| Molecular Formula | C23H24ClF3N4O4S |
| Molecular Weight | 544.98 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | tert-butyl N-[(5R)-5-[5-[(Z)-2-(5-chloro-2-pyridinyl)-2-fluoroethenyl]-2,3-difluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=N[C@](C)(c2cc(/C=C(\F)c3ccc(Cl)cn3)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C23H24ClF3N4O4S/c1-22(2,3)35-21(32)29-20-30-23(4,12-36(33,34)31(20)5)15-8-13(10-17(26)19(15)27)9-16(25)18-7-6-14(24)11-28-18/h6-11H,12H2,1-5H3,(H,29,30,32)/b16-9-/t23-/m0/s1 |
| InChIKey | LGTCQBPYJUCYAO-OUXDILKSSA-N |
| XLogP | 4.85 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.98 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |