C16H20F3N3O4S — CID 77411659
tert-butyl N-[2,5-dimethyl-1,1-dioxo-5-(2,3,6-trifluorophenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate (PubChem CID 77411659) has the molecular formula C16H20F3N3O4S and a molecular weight of 407.41 g/mol. Its IUPAC name is tert-butyl N-[2,5-dimethyl-1,1-dioxo-5-(2,3,6-trifluorophenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[2,5-dimethyl-1,1-dioxo-5-(2,3,6-trifluorophenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 77411659 |
| Molecular Formula | C16H20F3N3O4S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | tert-butyl N-[2,5-dimethyl-1,1-dioxo-5-(2,3,6-trifluorophenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=NC(C)(c2c(F)ccc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C16H20F3N3O4S/c1-15(2,3)26-14(23)20-13-21-16(4,8-27(24,25)22(13)5)11-9(17)6-7-10(18)12(11)19/h6-7H,8H2,1-5H3,(H,20,21,23) |
| InChIKey | PYNNMPKSDMEHHC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|