C16H19F3N4O6S — CID 88594147
tert-butyl N-[(5R)-2,5-dimethyl-1,1-dioxo-5-(2,3,6-trifluoro-5-nitrophenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate (PubChem CID 88594147) has the molecular formula C16H19F3N4O6S and a molecular weight of 452.41 g/mol. Its IUPAC name is tert-butyl N-[(5R)-2,5-dimethyl-1,1-dioxo-5-(2,3,6-trifluoro-5-nitrophenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5R)-2,5-dimethyl-1,1-dioxo-5-(2,3,6-trifluoro-5-nitrophenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 88594147 |
| Molecular Formula | C16H19F3N4O6S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | tert-butyl N-[(5R)-2,5-dimethyl-1,1-dioxo-5-(2,3,6-trifluoro-5-nitrophenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=N[C@](C)(c2c(F)c(F)cc([N+](=O)[O-])c2F)CS1(=O)=O |
| InChI | InChI=1S/C16H19F3N4O6S/c1-15(2,3)29-14(24)20-13-21-16(4,7-30(27,28)22(13)5)10-11(18)8(17)6-9(12(10)19)23(25)26/h6H,7H2,1-5H3,(H,20,21,24)/t16-/m0/s1 |
| InChIKey | LPLNYDDZZRPGFG-INIZCTEOSA-N |
| XLogP | 2.38 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|