C17H23F2N3O5S — CID 154601265
tert-butyl N-[(5R)-5-(2,3-difluoro-5-methoxyphenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate (PubChem CID 154601265) has the molecular formula C17H23F2N3O5S and a molecular weight of 419.45 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-(2,3-difluoro-5-methoxyphenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5R)-5-(2,3-difluoro-5-methoxyphenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 154601265 |
| Molecular Formula | C17H23F2N3O5S |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | tert-butyl N-[(5R)-5-(2,3-difluoro-5-methoxyphenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate |
| SMILES | COc1cc(F)c(F)c([C@]2(C)CS(=O)(=O)N(C)C(NC(=O)OC(C)(C)C)=N2)c1 |
| InChI | InChI=1S/C17H23F2N3O5S/c1-16(2,3)27-15(23)20-14-21-17(4,9-28(24,25)22(14)5)11-7-10(26-6)8-12(18)13(11)19/h7-8H,9H2,1-6H3,(H,20,21,23)/t17-/m0/s1 |
| InChIKey | VWMBKQOAGSHULH-KRWDZBQOSA-N |
| XLogP | 2.34 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |