C23H26ClN5O6S — CID 122535441
tert-butyl N-[(4R)-6-[(5-chloropyridine-2-carbonyl)amino]-2'-methyl-1',1'-dioxospiro[2,3-dihydrochromene-4,5'-6H-1,2,4-thiadiazine]-3'-yl]carbamate (PubChem CID 122535441) has the molecular formula C23H26ClN5O6S and a molecular weight of 536.01 g/mol. Its IUPAC name is tert-butyl N-[(4R)-6-[(5-chloropyridine-2-carbonyl)amino]-2'-methyl-1',1'-dioxospiro[2,3-dihydrochromene-4,5'-6H-1,2,4-thiadiazine]-3'-yl]carbamate.
| Compound Name | tert-butyl N-[(4R)-6-[(5-chloropyridine-2-carbonyl)amino]-2'-methyl-1',1'-dioxospiro[2,3-dihydrochromene-4,5'-6H-1,2,4-thiadiazine]-3'-yl]carbamate |
|---|---|
| PubChem CID | 122535441 |
| Molecular Formula | C23H26ClN5O6S |
| Molecular Weight | 536.01 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | tert-butyl N-[(4R)-6-[(5-chloropyridine-2-carbonyl)amino]-2'-methyl-1',1'-dioxospiro[2,3-dihydrochromene-4,5'-6H-1,2,4-thiadiazine]-3'-yl]carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=N[C@@]2(CCOc3ccc(NC(=O)c4ccc(Cl)cn4)cc32)CS1(=O)=O |
| InChI | InChI=1S/C23H26ClN5O6S/c1-22(2,3)35-21(31)27-20-28-23(13-36(32,33)29(20)4)9-10-34-18-8-6-15(11-16(18)23)26-19(30)17-7-5-14(24)12-25-17/h5-8,11-12H,9-10,13H2,1-4H3,(H,26,30)(H,27,28,31)/t23-/m0/s1 |
| InChIKey | FSJGTVPLDRFXAO-QHCPKHFHSA-N |
| XLogP | 3.12 |
| TPSA | 139.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.01 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |