C27H24ClN5O3 — CID 78105292
N-[2-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[5,6-dihydro-1,3-oxazine-4,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-chloropyridine-2-carboxamide (PubChem CID 78105292) has the molecular formula C27H24ClN5O3 and a molecular weight of 501.97 g/mol. Its IUPAC name is N-[2-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[5,6-dihydro-1,3-oxazine-4,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[2-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[5,6-dihydro-1,3-oxazine-4,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 78105292 |
| Molecular Formula | C27H24ClN5O3 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | N-[2-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[5,6-dihydro-1,3-oxazine-4,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-chloropyridine-2-carboxamide |
| SMILES | CC(C)(C)C#Cc1cc2c(cn1)Oc1ccc(NC(=O)c3ccc(Cl)cn3)cc1C21CCOC(N)=N1 |
| InChI | InChI=1S/C27H24ClN5O3/c1-26(2,3)9-8-17-12-20-23(15-30-17)36-22-7-5-18(32-24(34)21-6-4-16(28)14-31-21)13-19(22)27(20)10-11-35-25(29)33-27/h4-7,12-15H,10-11H2,1-3H3,(H2,29,33)(H,32,34) |
| InChIKey | PCMVRZAZIZIPGV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|