C27H24FN5O5 — CID 71542622
N-[(4S)-2-amino-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-fluorospiro[5,6-dihydro-1,3-oxazine-4,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-methoxypyridine-2-carboxamide (PubChem CID 71542622) has the molecular formula C27H24FN5O5 and a molecular weight of 517.52 g/mol. Its IUPAC name is N-[(4S)-2-amino-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-fluorospiro[5,6-dihydro-1,3-oxazine-4,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[(4S)-2-amino-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-fluorospiro[5,6-dihydro-1,3-oxazine-4,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 71542622 |
| Molecular Formula | C27H24FN5O5 |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-[(4S)-2-amino-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-fluorospiro[5,6-dihydro-1,3-oxazine-4,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)[C@@]2(CCOC(N)=N2)c2cc(C4=CCOCC4)nc(F)c2O3)nc1 |
| InChI | InChI=1S/C27H24FN5O5/c1-35-17-3-4-20(30-14-17)25(34)31-16-2-5-22-18(12-16)27(8-11-37-26(29)33-27)19-13-21(15-6-9-36-10-7-15)32-24(28)23(19)38-22/h2-6,12-14H,7-11H2,1H3,(H2,29,33)(H,31,34)/t27-/m0/s1 |
| InChIKey | ZXVUTPMCWBMAHM-MHZLTWQESA-N |
| XLogP | 3.76 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|