C27H24ClN5O4S — CID 71542233
N-[(6S)-2-amino-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-methoxyspiro[4,5-dihydro-1,3-thiazine-6,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-chloropyridine-2-carboxamide (PubChem CID 71542233) has the molecular formula C27H24ClN5O4S and a molecular weight of 550.04 g/mol. Its IUPAC name is N-[(6S)-2-amino-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-methoxyspiro[4,5-dihydro-1,3-thiazine-6,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[(6S)-2-amino-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-methoxyspiro[4,5-dihydro-1,3-thiazine-6,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 71542233 |
| Molecular Formula | C27H24ClN5O4S |
| Molecular Weight | 550.04 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | N-[(6S)-2-amino-3'-(3,6-dihydro-2H-pyran-4-yl)-1'-methoxyspiro[4,5-dihydro-1,3-thiazine-6,5'-chromeno[2,3-c]pyridine]-7'-yl]-5-chloropyridine-2-carboxamide |
| SMILES | COc1nc(C2=CCOCC2)cc2c1Oc1ccc(NC(=O)c3ccc(Cl)cn3)cc1[C@@]21CCN=C(N)S1 |
| InChI | InChI=1S/C27H24ClN5O4S/c1-35-25-23-19(13-21(33-25)15-6-10-36-11-7-15)27(8-9-30-26(29)38-27)18-12-17(3-5-22(18)37-23)32-24(34)20-4-2-16(28)14-31-20/h2-6,12-14H,7-11H2,1H3,(H2,29,30)(H,32,34)/t27-/m0/s1 |
| InChIKey | YGFVWLWQMCJGMX-MHZLTWQESA-N |
| XLogP | 5.00 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.04 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |