C19H22ClN5O4S — CID 123705785
N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-4-chloro-1-methylpyrazole-3-carboxamide (PubChem CID 123705785) has the molecular formula C19H22ClN5O4S and a molecular weight of 451.94 g/mol. Its IUPAC name is N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-4-chloro-1-methylpyrazole-3-carboxamide.
| Compound Name | N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-4-chloro-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 123705785 |
| Molecular Formula | C19H22ClN5O4S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N-(5'-amino-6',6'-dimethyl-1',1'-dioxospiro[2,3-dihydrochromene-4,3'-2H-1,4-thiazine]-6-yl)-4-chloro-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(Cl)c(C(=O)Nc2ccc3c(c2)C2(CCO3)CS(=O)(=O)C(C)(C)C(N)=N2)n1 |
| InChI | InChI=1S/C19H22ClN5O4S/c1-18(2)17(21)23-19(10-30(18,27)28)6-7-29-14-5-4-11(8-12(14)19)22-16(26)15-13(20)9-25(3)24-15/h4-5,8-9H,6-7,10H2,1-3H3,(H2,21,23)(H,22,26) |
| InChIKey | VOQKHPRWRQIQFV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |