C17H19FN4O4S — CID 89094950
N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-1,3-oxazole-4-carboxamide (PubChem CID 89094950) has the molecular formula C17H19FN4O4S and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 89094950 |
| Molecular Formula | C17H19FN4O4S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-1,3-oxazole-4-carboxamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(NC(=O)c3cocn3)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C17H19FN4O4S/c1-16(2)15(19)22-17(3,8-27(16,24)25)11-6-10(4-5-12(11)18)21-14(23)13-7-26-9-20-13/h4-7,9H,8H2,1-3H3,(H2,19,22)(H,21,23)/t17-/m0/s1 |
| InChIKey | CCDBGYQULIRJPM-KRWDZBQOSA-N |
| XLogP | 1.85 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |