C21H22F4N4O4S — CID 89095045
N-[3-[(3R,6R)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide (PubChem CID 89095045) has the molecular formula C21H22F4N4O4S and a molecular weight of 502.49 g/mol. Its IUPAC name is N-[3-[(3R,6R)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[3-[(3R,6R)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 89095045 |
| Molecular Formula | C21H22F4N4O4S |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | N-[3-[(3R,6R)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(F)c([C@]3(C)CS(=O)(=O)[C@](C)(CC(F)(F)F)C(N)=N3)c2)nc1 |
| InChI | InChI=1S/C21H22F4N4O4S/c1-19(11-34(31,32)20(2,18(26)29-19)10-21(23,24)25)14-8-12(4-6-15(14)22)28-17(30)16-7-5-13(33-3)9-27-16/h4-9H,10-11H2,1-3H3,(H2,26,29)(H,28,30)/t19-,20+/m0/s1 |
| InChIKey | STIIUEJIVDAURY-VQTJNVASSA-N |
| XLogP | 3.19 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |