C22H23F4N3O3S — CID 161444056
2-[3-[(3R,6R)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-1-(5-methyl-2-pyridinyl)ethanone (PubChem CID 161444056) has the molecular formula C22H23F4N3O3S and a molecular weight of 485.50 g/mol. Its IUPAC name is 2-[3-[(3R,6R)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-1-(5-methyl-2-pyridinyl)ethanone.
| Compound Name | 2-[3-[(3R,6R)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-1-(5-methyl-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 161444056 |
| Molecular Formula | C22H23F4N3O3S |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 2-[3-[(3R,6R)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-1-(5-methyl-2-pyridinyl)ethanone |
| SMILES | Cc1ccc(C(=O)Cc2ccc(F)c([C@]3(C)CS(=O)(=O)[C@](C)(CC(F)(F)F)C(N)=N3)c2)nc1 |
| InChI | InChI=1S/C22H23F4N3O3S/c1-13-4-7-17(28-10-13)18(30)9-14-5-6-16(23)15(8-14)20(2)12-33(31,32)21(3,19(27)29-20)11-22(24,25)26/h4-8,10H,9,11-12H2,1-3H3,(H2,27,29)/t20-,21+/m0/s1 |
| InChIKey | VZQTVMGMGHASHM-LEWJYISDSA-N |
| XLogP | 3.67 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |