C21H20F5N3O3S — CID 159584596
2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-1-[5-(trifluoromethyl)-2-pyridinyl]ethanone (PubChem CID 159584596) has the molecular formula C21H20F5N3O3S and a molecular weight of 489.47 g/mol. Its IUPAC name is 2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-1-[5-(trifluoromethyl)-2-pyridinyl]ethanone.
| Compound Name | 2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-1-[5-(trifluoromethyl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 159584596 |
| Molecular Formula | C21H20F5N3O3S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-1-[5-(trifluoromethyl)-2-pyridinyl]ethanone |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(CC(=O)c3ccc(C(F)(F)F)cn3)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C21H20F5N3O3S/c1-19(2)18(27)29-20(3,10-33(19,31)32)13-6-11(7-14(22)17(13)23)8-16(30)15-5-4-12(9-28-15)21(24,25)26/h4-7,9H,8,10H2,1-3H3,(H2,27,29)/t20-/m0/s1 |
| InChIKey | MJLLCJMXKBCCKE-FQEVSTJZSA-N |
| XLogP | 3.58 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |