C19H21F2N3O3S — CID 146802556
1-[2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]acetyl]cyclopropane-1-carbonitrile (PubChem CID 146802556) has the molecular formula C19H21F2N3O3S and a molecular weight of 409.46 g/mol. Its IUPAC name is 1-[2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]acetyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]acetyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 146802556 |
| Molecular Formula | C19H21F2N3O3S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-[2-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]acetyl]cyclopropane-1-carbonitrile |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(CC(=O)C3(C#N)CC3)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C19H21F2N3O3S/c1-17(2)16(23)24-18(3,10-28(17,26)27)12-6-11(7-13(20)15(12)21)8-14(25)19(9-22)4-5-19/h6-7H,4-5,8,10H2,1-3H3,(H2,23,24)/t18-/m0/s1 |
| InChIKey | RYEXKENSFHAKHQ-SFHVURJKSA-N |
| XLogP | 2.16 |
| TPSA | 113.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |