C18H21F4N3O3S — CID 89094952
N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2,2-difluorocyclobutane-1-carboxamide (PubChem CID 89094952) has the molecular formula C18H21F4N3O3S and a molecular weight of 435.44 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2,2-difluorocyclobutane-1-carboxamide.
| Compound Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2,2-difluorocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 89094952 |
| Molecular Formula | C18H21F4N3O3S |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2,2-difluorocyclobutane-1-carboxamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(NC(=O)C3CCC3(F)F)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C18H21F4N3O3S/c1-16(2)15(23)25-17(3,8-29(16,27)28)11-6-9(7-12(19)13(11)20)24-14(26)10-4-5-18(10,21)22/h6-7,10H,4-5,8H2,1-3H3,(H2,23,25)(H,24,26)/t10?,17-/m0/s1 |
| InChIKey | ODFQLKLNTCZZTK-LKDXBUKQSA-N |
| XLogP | 2.73 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |