C20H21F3N4O4S — CID 123325978
N-[3-(5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl)-4,5-difluorophenyl]-3-fluoro-5-methoxypyridine-2-carboxamide (PubChem CID 123325978) has the molecular formula C20H21F3N4O4S and a molecular weight of 470.47 g/mol. Its IUPAC name is N-[3-(5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl)-4,5-difluorophenyl]-3-fluoro-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[3-(5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl)-4,5-difluorophenyl]-3-fluoro-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 123325978 |
| Molecular Formula | C20H21F3N4O4S |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N-[3-(5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl)-4,5-difluorophenyl]-3-fluoro-5-methoxypyridine-2-carboxamide |
| SMILES | COc1cnc(C(=O)Nc2cc(F)c(F)c(C3(C)CS(=O)(=O)C(C)(C)C(N)=N3)c2)c(F)c1 |
| InChI | InChI=1S/C20H21F3N4O4S/c1-19(2)18(24)27-20(3,9-32(19,29)30)12-5-10(6-13(21)15(12)23)26-17(28)16-14(22)7-11(31-4)8-25-16/h5-8H,9H2,1-4H3,(H2,24,27)(H,26,28) |
| InChIKey | NYBUFMMBZQXQOA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |