C20H21F2N5O5S — CID 71468495
N-[3-[(4aS,7S,7aR)-3-amino-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-3-fluoro-5-methoxypyridine-2-carboxamide (PubChem CID 71468495) has the molecular formula C20H21F2N5O5S and a molecular weight of 481.48 g/mol. Its IUPAC name is N-[3-[(4aS,7S,7aR)-3-amino-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-3-fluoro-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[3-[(4aS,7S,7aR)-3-amino-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-3-fluoro-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 71468495 |
| Molecular Formula | C20H21F2N5O5S |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | N-[3-[(4aS,7S,7aR)-3-amino-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-3-fluoro-5-methoxypyridine-2-carboxamide |
| SMILES | COc1cnc(C(=O)Nc2ccc(F)c([C@]34CO[C@@H](C)[C@@H]3S(=O)(=O)N(C)C(N)=N4)c2)c(F)c1 |
| InChI | InChI=1S/C20H21F2N5O5S/c1-10-17-20(9-32-10,26-19(23)27(2)33(17,29)30)13-6-11(4-5-14(13)21)25-18(28)16-15(22)7-12(31-3)8-24-16/h4-8,10,17H,9H2,1-3H3,(H2,23,26)(H,25,28)/t10-,17-,20+/m0/s1 |
| InChIKey | AIHYUYXSWXCCED-WAMMUTHRSA-N |
| XLogP | 1.19 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |