C19H17F2N5O4S — CID 138722346
N-[3-[(4aS)-3-amino-2-methyl-1,1,6-trioxo-7,7a-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 138722346) has the molecular formula C19H17F2N5O4S and a molecular weight of 449.44 g/mol. Its IUPAC name is N-[3-[(4aS)-3-amino-2-methyl-1,1,6-trioxo-7,7a-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-[(4aS)-3-amino-2-methyl-1,1,6-trioxo-7,7a-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 138722346 |
| Molecular Formula | C19H17F2N5O4S |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[3-[(4aS)-3-amino-2-methyl-1,1,6-trioxo-7,7a-dihydro-5H-cyclopenta[e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | CN1C(N)=N[C@]2(c3cc(NC(=O)c4ccc(F)cn4)ccc3F)CC(=O)CC2S1(=O)=O |
| InChI | InChI=1S/C19H17F2N5O4S/c1-26-18(22)25-19(8-12(27)7-16(19)31(26,29)30)13-6-11(3-4-14(13)21)24-17(28)15-5-2-10(20)9-23-15/h2-6,9,16H,7-8H2,1H3,(H2,22,25)(H,24,28)/t16?,19-/m0/s1 |
| InChIKey | PEHZWSHCDRHDPK-CVMIBEPCSA-N |
| XLogP | 1.13 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |