C20H20F2N6O4S — CID 78077554
N-[3-(6-acetyl-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-pyrrolo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 78077554) has the molecular formula C20H20F2N6O4S and a molecular weight of 478.48 g/mol. Its IUPAC name is N-[3-(6-acetyl-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-pyrrolo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-(6-acetyl-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-pyrrolo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 78077554 |
| Molecular Formula | C20H20F2N6O4S |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | N-[3-(6-acetyl-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-pyrrolo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | CC(=O)N1CC2C(c3cc(NC(=O)c4ccc(F)cn4)ccc3F)(C1)N=C(N)N(C)S2(=O)=O |
| InChI | InChI=1S/C20H20F2N6O4S/c1-11(29)28-9-17-20(10-28,26-19(23)27(2)33(17,31)32)14-7-13(4-5-15(14)22)25-18(30)16-6-3-12(21)8-24-16/h3-8,17H,9-10H2,1-2H3,(H2,23,26)(H,25,30) |
| InChIKey | JDCNHYZNJNRUDX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 138.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |