C19H19F2N5O3S — CID 130394977
N-[3-(3-amino-2-methyl-1-oxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 130394977) has the molecular formula C19H19F2N5O3S and a molecular weight of 435.46 g/mol. Its IUPAC name is N-[3-(3-amino-2-methyl-1-oxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-(3-amino-2-methyl-1-oxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 130394977 |
| Molecular Formula | C19H19F2N5O3S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[3-(3-amino-2-methyl-1-oxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | CN1C(N)=NC2(c3cc(NC(=O)c4ccc(F)cn4)ccc3F)CCOCC2S1=O |
| InChI | InChI=1S/C19H19F2N5O3S/c1-26-18(22)25-19(6-7-29-10-16(19)30(26)28)13-8-12(3-4-14(13)21)24-17(27)15-5-2-11(20)9-23-15/h2-5,8-9,16H,6-7,10H2,1H3,(H2,22,25)(H,24,27) |
| InChIKey | PWFHQQDAKSKREG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |