C18H16F3N5O3S — CID 130394845
N-[3-(3-amino-2-methyl-1-oxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-3,5-difluoropyridine-2-carboxamide (PubChem CID 130394845) has the molecular formula C18H16F3N5O3S and a molecular weight of 439.42 g/mol. Its IUPAC name is N-[3-(3-amino-2-methyl-1-oxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-3,5-difluoropyridine-2-carboxamide.
| Compound Name | N-[3-(3-amino-2-methyl-1-oxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-3,5-difluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 130394845 |
| Molecular Formula | C18H16F3N5O3S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[3-(3-amino-2-methyl-1-oxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-3,5-difluoropyridine-2-carboxamide |
| SMILES | CN1C(N)=NC2(c3cc(NC(=O)c4ncc(F)cc4F)ccc3F)CCOC2S1=O |
| InChI | InChI=1S/C18H16F3N5O3S/c1-26-17(22)25-18(4-5-29-16(18)30(26)28)11-7-10(2-3-12(11)20)24-15(27)14-13(21)6-9(19)8-23-14/h2-3,6-8,16H,4-5H2,1H3,(H2,22,25)(H,24,27) |
| InChIKey | BTKXWFNIIJTCAB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |