C19H18F2N4O2S — CID 67279489
N-[3-(2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 67279489) has the molecular formula C19H18F2N4O2S and a molecular weight of 404.44 g/mol. Its IUPAC name is N-[3-(2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-(2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 67279489 |
| Molecular Formula | C19H18F2N4O2S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[3-(2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | NC1=NC2(c3cc(NC(=O)c4ccc(F)cn4)ccc3F)CCOCC2CS1 |
| InChI | InChI=1S/C19H18F2N4O2S/c20-12-1-4-16(23-8-12)17(26)24-13-2-3-15(21)14(7-13)19-5-6-27-9-11(19)10-28-18(22)25-19/h1-4,7-8,11H,5-6,9-10H2,(H2,22,25)(H,24,26) |
| InChIKey | OPKZPRVPAIRLGX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |