C18H16F3N5O2S — CID 123924677
N-[3-[(4aS,7aR)-2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-(difluoromethyl)pyrazine-2-carboxamide (PubChem CID 123924677) has the molecular formula C18H16F3N5O2S and a molecular weight of 423.42 g/mol. Its IUPAC name is N-[3-[(4aS,7aR)-2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-(difluoromethyl)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(4aS,7aR)-2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-(difluoromethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123924677 |
| Molecular Formula | C18H16F3N5O2S |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[3-[(4aS,7aR)-2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-(difluoromethyl)pyrazine-2-carboxamide |
| SMILES | NC1=N[C@]2(c3cc(NC(=O)c4cnc(C(F)F)cn4)ccc3F)COC[C@H]2CS1 |
| InChI | InChI=1S/C18H16F3N5O2S/c19-12-2-1-10(25-16(27)14-5-23-13(4-24-14)15(20)21)3-11(12)18-8-28-6-9(18)7-29-17(22)26-18/h1-5,9,15H,6-8H2,(H2,22,26)(H,25,27)/t9-,18+/m0/s1 |
| InChIKey | UDHSCEVZTLYMBO-NIVTXAMTSA-N |
| XLogP | 2.71 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |