C20H19F3N4O2S — CID 59621290
2-[3-[(4aS,8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-1-[5-(difluoromethyl)pyrazin-2-yl]ethanone (PubChem CID 59621290) has the molecular formula C20H19F3N4O2S and a molecular weight of 436.46 g/mol. Its IUPAC name is 2-[3-[(4aS,8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-1-[5-(difluoromethyl)pyrazin-2-yl]ethanone.
| Compound Name | 2-[3-[(4aS,8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-1-[5-(difluoromethyl)pyrazin-2-yl]ethanone |
|---|---|
| PubChem CID | 59621290 |
| Molecular Formula | C20H19F3N4O2S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-[3-[(4aS,8aS)-2-amino-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-1-[5-(difluoromethyl)pyrazin-2-yl]ethanone |
| SMILES | NC1=N[C@@]2(c3cc(CC(=O)c4cnc(C(F)F)cn4)ccc3F)CCOC[C@H]2CS1 |
| InChI | InChI=1S/C20H19F3N4O2S/c21-14-2-1-11(6-17(28)15-7-26-16(8-25-15)18(22)23)5-13(14)20-3-4-29-9-12(20)10-30-19(24)27-20/h1-2,5,7-8,12,18H,3-4,6,9-10H2,(H2,24,27)/t12-,20-/m0/s1 |
| InChIKey | GNJHEWWUKCUWAF-YUNKPMOVSA-N |
| XLogP | 3.27 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |