C23H23FN4O2S — CID 160721765
6-[2-[3-[(4aR,7S,8aS)-2-amino-7-methoxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-8a-yl]-4-fluorophenyl]acetyl]pyridine-3-carbonitrile (PubChem CID 160721765) has the molecular formula C23H23FN4O2S and a molecular weight of 438.53 g/mol. Its IUPAC name is 6-[2-[3-[(4aR,7S,8aS)-2-amino-7-methoxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-8a-yl]-4-fluorophenyl]acetyl]pyridine-3-carbonitrile.
| Compound Name | 6-[2-[3-[(4aR,7S,8aS)-2-amino-7-methoxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-8a-yl]-4-fluorophenyl]acetyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 160721765 |
| Molecular Formula | C23H23FN4O2S |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 6-[2-[3-[(4aR,7S,8aS)-2-amino-7-methoxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-8a-yl]-4-fluorophenyl]acetyl]pyridine-3-carbonitrile |
| SMILES | CO[C@H]1CC[C@H]2CSC(N)=N[C@@]2(c2cc(CC(=O)c3ccc(C#N)cn3)ccc2F)C1 |
| InChI | InChI=1S/C23H23FN4O2S/c1-30-17-5-4-16-13-31-22(26)28-23(16,10-17)18-8-14(2-6-19(18)24)9-21(29)20-7-3-15(11-25)12-27-20/h2-3,6-8,12,16-17H,4-5,9-10,13H2,1H3,(H2,26,28)/t16-,17-,23-/m0/s1 |
| InChIKey | RTESNDXCCONLBM-QQMNAOGKSA-N |
| XLogP | 3.59 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |