C21H18F4N4O2 — CID 162100714
6-[2-[3-[(4S,5R,6S)-2-amino-4,5-dimethyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]acetyl]pyridine-3-carbonitrile (PubChem CID 162100714) has the molecular formula C21H18F4N4O2 and a molecular weight of 434.39 g/mol. Its IUPAC name is 6-[2-[3-[(4S,5R,6S)-2-amino-4,5-dimethyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]acetyl]pyridine-3-carbonitrile.
| Compound Name | 6-[2-[3-[(4S,5R,6S)-2-amino-4,5-dimethyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]acetyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 162100714 |
| Molecular Formula | C21H18F4N4O2 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 6-[2-[3-[(4S,5R,6S)-2-amino-4,5-dimethyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]acetyl]pyridine-3-carbonitrile |
| SMILES | C[C@H]1[C@@H](C(F)(F)F)OC(N)=N[C@]1(C)c1cc(CC(=O)c2ccc(C#N)cn2)ccc1F |
| InChI | InChI=1S/C21H18F4N4O2/c1-11-18(21(23,24)25)31-19(27)29-20(11,2)14-7-12(3-5-15(14)22)8-17(30)16-6-4-13(9-26)10-28-16/h3-7,10-11,18H,8H2,1-2H3,(H2,27,29)/t11-,18-,20-/m0/s1 |
| InChIKey | ZEVPAXRRUVCWDG-SLIIYKDFSA-N |
| XLogP | 3.64 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |