C21H20FN5O3S — CID 118033381
N-[3-[(6R,8aS)-2-amino-6-(hydroxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide (PubChem CID 118033381) has the molecular formula C21H20FN5O3S and a molecular weight of 441.49 g/mol. Its IUPAC name is N-[3-[(6R,8aS)-2-amino-6-(hydroxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[3-[(6R,8aS)-2-amino-6-(hydroxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 118033381 |
| Molecular Formula | C21H20FN5O3S |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[3-[(6R,8aS)-2-amino-6-(hydroxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc(F)c([C@]34CO[C@@H](CO)CC3CSC(N)=N4)c2)nc1 |
| InChI | InChI=1S/C21H20FN5O3S/c22-17-3-2-14(26-19(29)18-4-1-12(7-23)8-25-18)6-16(17)21-11-30-15(9-28)5-13(21)10-31-20(24)27-21/h1-4,6,8,13,15,28H,5,9-11H2,(H2,24,27)(H,26,29)/t13?,15-,21+/m1/s1 |
| InChIKey | IECYYIJRTTVXLG-MUZZAQLWSA-N |
| XLogP | 2.00 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |