C20H18F4N4O2S — CID 45278900
N-[3-[(4aR,6R,8aS)-2-amino-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]pyridine-2-carboxamide (PubChem CID 45278900) has the molecular formula C20H18F4N4O2S and a molecular weight of 454.45 g/mol. Its IUPAC name is N-[3-[(4aR,6R,8aS)-2-amino-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]pyridine-2-carboxamide.
| Compound Name | N-[3-[(4aR,6R,8aS)-2-amino-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 45278900 |
| Molecular Formula | C20H18F4N4O2S |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-[3-[(4aR,6R,8aS)-2-amino-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]pyridine-2-carboxamide |
| SMILES | NC1=N[C@@]2(c3cc(NC(=O)c4ccccn4)ccc3F)CO[C@@H](C(F)(F)F)C[C@H]2CS1 |
| InChI | InChI=1S/C20H18F4N4O2S/c21-14-5-4-12(27-17(29)15-3-1-2-6-26-15)8-13(14)19-10-30-16(20(22,23)24)7-11(19)9-31-18(25)28-19/h1-6,8,11,16H,7,9-10H2,(H2,25,28)(H,27,29)/t11-,16+,19-/m0/s1 |
| InChIKey | OXGVEZKJDWFRMC-MAAWUACBSA-N |
| XLogP | 3.70 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |