C21H18F3N5O2S — CID 139364835
N-[3-[(4aS)-2-amino-5-(1,1-difluoroethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide (PubChem CID 139364835) has the molecular formula C21H18F3N5O2S and a molecular weight of 461.47 g/mol. Its IUPAC name is N-[3-[(4aS)-2-amino-5-(1,1-difluoroethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[3-[(4aS)-2-amino-5-(1,1-difluoroethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 139364835 |
| Molecular Formula | C21H18F3N5O2S |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-[3-[(4aS)-2-amino-5-(1,1-difluoroethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
| SMILES | CC(F)(F)C1OCC2(c3cc(NC(=O)c4ccc(C#N)cn4)ccc3F)N=C(N)SC[C@H]12 |
| InChI | InChI=1S/C21H18F3N5O2S/c1-20(23,24)17-14-9-32-19(26)29-21(14,10-31-17)13-6-12(3-4-15(13)22)28-18(30)16-5-2-11(7-25)8-27-16/h2-6,8,14,17H,9-10H2,1H3,(H2,26,29)(H,28,30)/t14-,17?,21?/m1/s1 |
| InChIKey | JJADJMODPHLYCB-OKSICCMJSA-N |
| XLogP | 3.27 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |