C23H18F4N6O2 — CID 146414759
N-[3-[(3S,4aR,5R,7aR)-2-amino-3-cyano-3-methyl-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide (PubChem CID 146414759) has the molecular formula C23H18F4N6O2 and a molecular weight of 486.43 g/mol. Its IUPAC name is N-[3-[(3S,4aR,5R,7aR)-2-amino-3-cyano-3-methyl-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[3-[(3S,4aR,5R,7aR)-2-amino-3-cyano-3-methyl-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 146414759 |
| Molecular Formula | C23H18F4N6O2 |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | N-[3-[(3S,4aR,5R,7aR)-2-amino-3-cyano-3-methyl-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
| SMILES | C[C@@]1(C#N)C[C@H]2[C@H](C(F)(F)F)OC[C@@]2(c2cc(NC(=O)c3ccc(C#N)cn3)ccc2F)N=C1N |
| InChI | InChI=1S/C23H18F4N6O2/c1-21(10-29)7-15-18(23(25,26)27)35-11-22(15,33-20(21)30)14-6-13(3-4-16(14)24)32-19(34)17-5-2-12(8-28)9-31-17/h2-6,9,15,18H,7,11H2,1H3,(H2,30,33)(H,32,34)/t15-,18+,21-,22-/m0/s1 |
| InChIKey | XRVXJBBCTGPPSQ-XSLZUNGDSA-N |
| XLogP | 3.41 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |