C23H22FN9O2 — CID 146414572
N-[3-[(3S,4aS,5R,7aS)-2-amino-3-cyano-3,5-dimethyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide (PubChem CID 146414572) has the molecular formula C23H22FN9O2 and a molecular weight of 475.49 g/mol. Its IUPAC name is N-[3-[(3S,4aS,5R,7aS)-2-amino-3-cyano-3,5-dimethyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(3S,4aS,5R,7aS)-2-amino-3-cyano-3,5-dimethyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 146414572 |
| Molecular Formula | C23H22FN9O2 |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[3-[(3S,4aS,5R,7aS)-2-amino-3-cyano-3,5-dimethyl-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4-fluorophenyl]-5-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide |
| SMILES | C[C@H]1OC[C@]2(c3cc(NC(=O)c4cnc(-n5cncn5)cn4)ccc3F)N=C(N)[C@](C)(C#N)C[C@H]12 |
| InChI | InChI=1S/C23H22FN9O2/c1-13-16-6-22(2,9-25)21(26)32-23(16,10-35-13)15-5-14(3-4-17(15)24)31-20(34)18-7-29-19(8-28-18)33-12-27-11-30-33/h3-5,7-8,11-13,16H,6,10H2,1-2H3,(H2,26,32)(H,31,34)/t13-,16-,22+,23-/m1/s1 |
| InChIKey | GZWBRMVBMDVYCC-LQFOCNHFSA-N |
| XLogP | 1.97 |
| TPSA | 156.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |