C19H19ClFN5O4S — CID 71468249
N-[3-[(4aS,7S,7aR)-3-amino-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide (PubChem CID 71468249) has the molecular formula C19H19ClFN5O4S and a molecular weight of 467.91 g/mol. Its IUPAC name is N-[3-[(4aS,7S,7aR)-3-amino-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[3-[(4aS,7S,7aR)-3-amino-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 71468249 |
| Molecular Formula | C19H19ClFN5O4S |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | N-[3-[(4aS,7S,7aR)-3-amino-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide |
| SMILES | C[C@@H]1OC[C@]2(c3cc(NC(=O)c4ccc(Cl)cn4)ccc3F)N=C(N)N(C)S(=O)(=O)[C@@H]12 |
| InChI | InChI=1S/C19H19ClFN5O4S/c1-10-16-19(9-30-10,25-18(22)26(2)31(16,28)29)13-7-12(4-5-14(13)21)24-17(27)15-6-3-11(20)8-23-15/h3-8,10,16H,9H2,1-2H3,(H2,22,25)(H,24,27)/t10-,16-,19+/m0/s1 |
| InChIKey | PVPZCASXQLGAEV-WMRHFDQTSA-N |
| XLogP | 1.70 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |