C19H20FN5O5S — CID 78078198
N-[3-(3-amino-2-methyl-1,1-dioxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-methoxypyridine-2-carboxamide (PubChem CID 78078198) has the molecular formula C19H20FN5O5S and a molecular weight of 449.46 g/mol. Its IUPAC name is N-[3-(3-amino-2-methyl-1,1-dioxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[3-(3-amino-2-methyl-1,1-dioxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 78078198 |
| Molecular Formula | C19H20FN5O5S |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | N-[3-(3-amino-2-methyl-1,1-dioxo-6,7a-dihydro-5H-furo[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(F)c(C34CCOC3S(=O)(=O)N(C)C(N)=N4)c2)nc1 |
| InChI | InChI=1S/C19H20FN5O5S/c1-25-18(21)24-19(7-8-30-17(19)31(25,27)28)13-9-11(3-5-14(13)20)23-16(26)15-6-4-12(29-2)10-22-15/h3-6,9-10,17H,7-8H2,1-2H3,(H2,21,24)(H,23,26) |
| InChIKey | FCCQMYPJYZJNRS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |