C20H22FN5O3S — CID 130394930
N-[3-(3-amino-2-methyl-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-methoxypyridine-2-carboxamide (PubChem CID 130394930) has the molecular formula C20H22FN5O3S and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[3-(3-amino-2-methyl-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[3-(3-amino-2-methyl-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 130394930 |
| Molecular Formula | C20H22FN5O3S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[3-(3-amino-2-methyl-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-4a-yl)-4-fluorophenyl]-5-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(F)c(C34CCCOC3SN(C)C(N)=N4)c2)nc1 |
| InChI | InChI=1S/C20H22FN5O3S/c1-26-19(22)25-20(8-3-9-29-18(20)30-26)14-10-12(4-6-15(14)21)24-17(27)16-7-5-13(28-2)11-23-16/h4-7,10-11,18H,3,8-9H2,1-2H3,(H2,22,25)(H,24,27) |
| InChIKey | ZHUFDRILVSNHDW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|