C20H18F4N4O3S — CID 76555705
N-[3-[2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide (PubChem CID 76555705) has the molecular formula C20H18F4N4O3S and a molecular weight of 470.45 g/mol. Its IUPAC name is N-[3-[2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[3-[2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 76555705 |
| Molecular Formula | C20H18F4N4O3S |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-[3-[2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(F)c(C34COC(C(F)(F)F)C3CSC(N)=N4)c2)nc1 |
| InChI | InChI=1S/C20H18F4N4O3S/c1-30-11-3-5-15(26-7-11)17(29)27-10-2-4-14(21)12(6-10)19-9-31-16(20(22,23)24)13(19)8-32-18(25)28-19/h2-7,13,16H,8-9H2,1H3,(H2,25,28)(H,27,29) |
| InChIKey | GNILMYPJAJAXTP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |