C22H22F5N5O2S — CID 123629313
N-[3-[2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4,5-difluorophenyl]-5-butylpyrazine-2-carboxamide (PubChem CID 123629313) has the molecular formula C22H22F5N5O2S and a molecular weight of 515.51 g/mol. Its IUPAC name is N-[3-[2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4,5-difluorophenyl]-5-butylpyrazine-2-carboxamide.
| Compound Name | N-[3-[2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4,5-difluorophenyl]-5-butylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123629313 |
| Molecular Formula | C22H22F5N5O2S |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | N-[3-[2-amino-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4,5-difluorophenyl]-5-butylpyrazine-2-carboxamide |
| SMILES | CCCCc1cnc(C(=O)Nc2cc(F)c(F)c(C34COC(C(F)(F)F)C3CSC(N)=N4)c2)cn1 |
| InChI | InChI=1S/C22H22F5N5O2S/c1-2-3-4-11-7-30-16(8-29-11)19(33)31-12-5-13(17(24)15(23)6-12)21-10-34-18(22(25,26)27)14(21)9-35-20(28)32-21/h5-8,14,18H,2-4,9-10H2,1H3,(H2,28,32)(H,31,33) |
| InChIKey | RQDKETORBKFCDO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |