C20H20F2N4O2S — CID 160557601
2-[3-[(4aS,5R,7aS)-2-amino-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1-[5-(fluoromethyl)pyrazin-2-yl]ethanone (PubChem CID 160557601) has the molecular formula C20H20F2N4O2S and a molecular weight of 418.47 g/mol. Its IUPAC name is 2-[3-[(4aS,5R,7aS)-2-amino-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1-[5-(fluoromethyl)pyrazin-2-yl]ethanone.
| Compound Name | 2-[3-[(4aS,5R,7aS)-2-amino-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1-[5-(fluoromethyl)pyrazin-2-yl]ethanone |
|---|---|
| PubChem CID | 160557601 |
| Molecular Formula | C20H20F2N4O2S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-[3-[(4aS,5R,7aS)-2-amino-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1-[5-(fluoromethyl)pyrazin-2-yl]ethanone |
| SMILES | C[C@H]1OC[C@]2(c3cc(CC(=O)c4cnc(CF)cn4)ccc3F)N=C(N)SC[C@H]12 |
| InChI | InChI=1S/C20H20F2N4O2S/c1-11-15-9-29-19(23)26-20(15,10-28-11)14-4-12(2-3-16(14)22)5-18(27)17-8-24-13(6-21)7-25-17/h2-4,7-8,11,15H,5-6,9-10H2,1H3,(H2,23,26)/t11-,15-,20-/m1/s1 |
| InChIKey | DPAVBWCYOBZWLR-CVWILIBFSA-N |
| XLogP | 2.80 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |