C18H18FN3O2S — CID 57415615
6-[3-[(4aS,5R,7aS)-2-amino-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1H-pyridin-2-one (PubChem CID 57415615) has the molecular formula C18H18FN3O2S and a molecular weight of 359.43 g/mol. Its IUPAC name is 6-[3-[(4aS,5R,7aS)-2-amino-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1H-pyridin-2-one.
| Compound Name | 6-[3-[(4aS,5R,7aS)-2-amino-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 57415615 |
| Molecular Formula | C18H18FN3O2S |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 6-[3-[(4aS,5R,7aS)-2-amino-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1H-pyridin-2-one |
| SMILES | C[C@H]1OC[C@]2(c3cc(-c4cccc(=O)[nH]4)ccc3F)N=C(N)SC[C@H]12 |
| InChI | InChI=1S/C18H18FN3O2S/c1-10-13-8-25-17(20)22-18(13,9-24-10)12-7-11(5-6-14(12)19)15-3-2-4-16(23)21-15/h2-7,10,13H,8-9H2,1H3,(H2,20,22)(H,21,23)/t10-,13-,18-/m1/s1 |
| InChIKey | IGKFANLNSAIWGB-AJAPIDPKSA-N |
| XLogP | 2.47 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |