C20H18F3N3O2S — CID 147172597
2-[3-[(4aS,5S,7aS)-2-amino-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone (PubChem CID 147172597) has the molecular formula C20H18F3N3O2S and a molecular weight of 421.44 g/mol. Its IUPAC name is 2-[3-[(4aS,5S,7aS)-2-amino-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone.
| Compound Name | 2-[3-[(4aS,5S,7aS)-2-amino-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 147172597 |
| Molecular Formula | C20H18F3N3O2S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-[3-[(4aS,5S,7aS)-2-amino-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone |
| SMILES | NC1=N[C@@]2(c3cc(CC(=O)c4ccc(F)cn4)ccc3F)CO[C@H](CF)[C@H]2CS1 |
| InChI | InChI=1S/C20H18F3N3O2S/c21-7-18-14-9-29-19(24)26-20(14,10-28-18)13-5-11(1-3-15(13)23)6-17(27)16-4-2-12(22)8-25-16/h1-5,8,14,18H,6-7,9-10H2,(H2,24,26)/t14-,18-,20-/m1/s1 |
| InChIKey | BXZWSSDDHSCAIC-LXGCGDOSSA-N |
| XLogP | 3.03 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |