C15H19F2N3OS — CID 143834654
5-(fluoromethyl)-8a-[2-fluoro-5-(methylamino)phenyl]-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine (PubChem CID 143834654) has the molecular formula C15H19F2N3OS and a molecular weight of 327.40 g/mol. Its IUPAC name is 5-(fluoromethyl)-8a-[2-fluoro-5-(methylamino)phenyl]-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine.
| Compound Name | 5-(fluoromethyl)-8a-[2-fluoro-5-(methylamino)phenyl]-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 143834654 |
| Molecular Formula | C15H19F2N3OS |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 5-(fluoromethyl)-8a-[2-fluoro-5-(methylamino)phenyl]-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine |
| SMILES | CNc1ccc(F)c(C23CCOC(CF)C2CSC(N)=N3)c1 |
| InChI | InChI=1S/C15H19F2N3OS/c1-19-9-2-3-12(17)10(6-9)15-4-5-21-13(7-16)11(15)8-22-14(18)20-15/h2-3,6,11,13,19H,4-5,7-8H2,1H3,(H2,18,20) |
| InChIKey | FINRDDYAGBPBLQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |