C22H26FN3OS — CID 143834764
8a-[2-fluoro-5-(methylamino)phenyl]-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine;benzaldehyde (PubChem CID 143834764) has the molecular formula C22H26FN3OS and a molecular weight of 399.54 g/mol. Its IUPAC name is 8a-[2-fluoro-5-(methylamino)phenyl]-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine;benzaldehyde.
| Compound Name | 8a-[2-fluoro-5-(methylamino)phenyl]-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine;benzaldehyde |
|---|---|
| PubChem CID | 143834764 |
| Molecular Formula | C22H26FN3OS |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 8a-[2-fluoro-5-(methylamino)phenyl]-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-amine;benzaldehyde |
| SMILES | CNc1ccc(F)c(C23CCCCC2CSC(N)=N3)c1.O=Cc1ccccc1 |
| InChI | InChI=1S/C15H20FN3S.C7H6O/c1-18-11-5-6-13(16)12(8-11)15-7-3-2-4-10(15)9-20-14(17)19-15;8-6-7-4-2-1-3-5-7/h5-6,8,10,18H,2-4,7,9H2,1H3,(H2,17,19);1-6H |
| InChIKey | LHFSUBWFMGKAME-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|