C19H19ClFN5OS — CID 76576827
N-[3-(2-amino-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-8a-yl)-4-fluorophenyl]-6-chloropyridazine-3-carboxamide (PubChem CID 76576827) has the molecular formula C19H19ClFN5OS and a molecular weight of 419.91 g/mol. Its IUPAC name is N-[3-(2-amino-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-8a-yl)-4-fluorophenyl]-6-chloropyridazine-3-carboxamide.
| Compound Name | N-[3-(2-amino-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-8a-yl)-4-fluorophenyl]-6-chloropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 76576827 |
| Molecular Formula | C19H19ClFN5OS |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-[3-(2-amino-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-8a-yl)-4-fluorophenyl]-6-chloropyridazine-3-carboxamide |
| SMILES | NC1=NC2(c3cc(NC(=O)c4ccc(Cl)nn4)ccc3F)CCCCC2CS1 |
| InChI | InChI=1S/C19H19ClFN5OS/c20-16-7-6-15(25-26-16)17(27)23-12-4-5-14(21)13(9-12)19-8-2-1-3-11(19)10-28-18(22)24-19/h4-7,9,11H,1-3,8,10H2,(H2,22,24)(H,23,27) |
| InChIKey | ZYNGGSWQDACIEI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |